C23H29N2O6P — CID 118716146
[2-amino-2-(hydroxymethyl)-4-[4-[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate (PubChem CID 118716146) has the molecular formula C23H29N2O6P and a molecular weight of 460.47 g/mol. Its IUPAC name is [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate.
| Compound Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118716146 |
| Molecular Formula | C23H29N2O6P |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [2-amino-2-(hydroxymethyl)-4-[4-[2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]phenyl]butyl] dihydrogen phosphate |
| SMILES | CC(C)c1ccc(-c2nc(-c3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)co2)cc1 |
| InChI | InChI=1S/C23H29N2O6P/c1-16(2)18-7-9-20(10-8-18)22-25-21(13-30-22)19-5-3-17(4-6-19)11-12-23(24,14-26)15-31-32(27,28)29/h3-10,13,16,26H,11-12,14-15,24H2,1-2H3,(H2,27,28,29) |
| InChIKey | LJOJKDPJECUQMO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|