C25H30N4O3 — CID 118716167
N-methyl-5-(4-piperazin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine (PubChem CID 118716167) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-methyl-5-(4-piperazin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine.
| Compound Name | N-methyl-5-(4-piperazin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 118716167 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-methyl-5-(4-piperazin-1-ylphenyl)-3-(3,4,5-trimethoxyphenyl)pyridin-2-amine |
| SMILES | CNc1ncc(-c2ccc(N3CCNCC3)cc2)cc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H30N4O3/c1-26-25-21(18-14-22(30-2)24(32-4)23(15-18)31-3)13-19(16-28-25)17-5-7-20(8-6-17)29-11-9-27-10-12-29/h5-8,13-16,27H,9-12H2,1-4H3,(H,26,28) |
| InChIKey | PHVIDGNOESEQKP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |