C24H41NaO5S — CID 118716221
sodium [(4R)-4-[(5S,7S,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] sulfate (PubChem CID 118716221) has the molecular formula C24H41NaO5S and a molecular weight of 464.64 g/mol. Its IUPAC name is sodium [(4R)-4-[(5S,7S,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] sulfate.
| Compound Name | sodium [(4R)-4-[(5S,7S,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] sulfate |
|---|---|
| PubChem CID | 118716221 |
| Molecular Formula | C24H41NaO5S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | sodium [(4R)-4-[(5S,7S,8R,9S,10S,13R,14S,17R)-7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl] sulfate |
| SMILES | C[C@H](CCCOS(=O)(=O)[O-])[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C.[Na+] |
| InChI | InChI=1S/C24H42O5S.Na/c1-16(7-6-14-29-30(26,27)28)18-9-10-19-22-20(11-13-24(18,19)3)23(2)12-5-4-8-17(23)15-21(22)25;/h16-22,25H,4-15H2,1-3H3,(H,26,27,28);/q;+1/p-1/t16-,17+,18-,19+,20+,21+,22+,23+,24-;/m1./s1 |
| InChIKey | WKZOALSUSRGOPP-LAGQSNGRSA-M |
| XLogP | 1.90 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|