C19H25N5O4S — CID 118716283
N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]heptanediamide (PubChem CID 118716283) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]heptanediamide.
| Compound Name | N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]heptanediamide |
|---|---|
| PubChem CID | 118716283 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1nnc(-c2ccc(N3CCOCC3)cc2)s1)NO |
| InChI | InChI=1S/C19H25N5O4S/c25-16(4-2-1-3-5-17(26)23-27)20-19-22-21-18(29-19)14-6-8-15(9-7-14)24-10-12-28-13-11-24/h6-9,27H,1-5,10-13H2,(H,23,26)(H,20,22,25) |
| InChIKey | UYHANQDLEKPBQC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|