C15H17ClN4O3S — CID 118716292
N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyheptanediamide (PubChem CID 118716292) has the molecular formula C15H17ClN4O3S and a molecular weight of 368.85 g/mol. Its IUPAC name is N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyheptanediamide.
| Compound Name | N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 118716292 |
| Molecular Formula | C15H17ClN4O3S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-N'-hydroxyheptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1nnc(-c2ccccc2Cl)s1)NO |
| InChI | InChI=1S/C15H17ClN4O3S/c16-11-7-5-4-6-10(11)14-18-19-15(24-14)17-12(21)8-2-1-3-9-13(22)20-23/h4-7,23H,1-3,8-9H2,(H,20,22)(H,17,19,21) |
| InChIKey | APTCRZDGAFKVHM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|