C15H17N5O5S — CID 118716296
N'-hydroxy-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]heptanediamide (PubChem CID 118716296) has the molecular formula C15H17N5O5S and a molecular weight of 379.40 g/mol. Its IUPAC name is N'-hydroxy-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]heptanediamide.
| Compound Name | N'-hydroxy-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]heptanediamide |
|---|---|
| PubChem CID | 118716296 |
| Molecular Formula | C15H17N5O5S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N'-hydroxy-N-[5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl]heptanediamide |
| SMILES | O=C(CCCCCC(=O)Nc1nnc(-c2ccc([N+](=O)[O-])cc2)s1)NO |
| InChI | InChI=1S/C15H17N5O5S/c21-12(4-2-1-3-5-13(22)19-23)16-15-18-17-14(26-15)10-6-8-11(9-7-10)20(24)25/h6-9,23H,1-5H2,(H,19,22)(H,16,18,21) |
| InChIKey | IFANWMNTQVWYIR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|