C20H27N5O4S — CID 118716298
N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]octanediamide (PubChem CID 118716298) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]octanediamide.
| Compound Name | N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]octanediamide |
|---|---|
| PubChem CID | 118716298 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N'-hydroxy-N-[5-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-yl]octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1nnc(-c2ccc(N3CCOCC3)cc2)s1)NO |
| InChI | InChI=1S/C20H27N5O4S/c26-17(5-3-1-2-4-6-18(27)24-28)21-20-23-22-19(30-20)15-7-9-16(10-8-15)25-11-13-29-14-12-25/h7-10,28H,1-6,11-14H2,(H,24,27)(H,21,23,26) |
| InChIKey | DMWVMQHFEBZGDB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|