C32H48N8O5 — CID 118716326
(3S,4S)-4-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylcarbamoylamino)pentanoyl]amino]propanoyl]amino]-3-hydroxy-6-methyl-N-(2-phenylethyl)heptanamide (PubChem CID 118716326) has the molecular formula C32H48N8O5 and a molecular weight of 624.79 g/mol. Its IUPAC name is (3S,4S)-4-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylcarbamoylamino)pentanoyl]amino]propanoyl]amino]-3-hydroxy-6-methyl-N-(2-phenylethyl)heptanamide.
| Compound Name | (3S,4S)-4-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylcarbamoylamino)pentanoyl]amino]propanoyl]amino]-3-hydroxy-6-methyl-N-(2-phenylethyl)heptanamide |
|---|---|
| PubChem CID | 118716326 |
| Molecular Formula | C32H48N8O5 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | (3S,4S)-4-[[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(phenylcarbamoylamino)pentanoyl]amino]propanoyl]amino]-3-hydroxy-6-methyl-N-(2-phenylethyl)heptanamide |
| SMILES | CC(C)CC(NC(=O)[C@H](C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)Nc1ccccc1)[C@@H](O)CC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C32H48N8O5/c1-21(2)19-26(27(41)20-28(42)35-18-16-23-11-6-4-7-12-23)39-29(43)22(3)37-30(44)25(15-10-17-36-31(33)34)40-32(45)38-24-13-8-5-9-14-24/h4-9,11-14,21-22,25-27,41H,10,15-20H2,1-3H3,(H,35,42)(H,37,44)(H,39,43)(H4,33,34,36)(H2,38,40,45)/t22-,25-,26?,27-/m0/s1 |
| InChIKey | GHHSBDUNWATBEB-ZDNCQAEVSA-N |
| XLogP | 1.38 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|