C22H32O5 — CID 118716355
(1R,2R,4aS,4bR,6S,7S,10aS)-2-acetyloxy-7-ethenyl-6-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 118716355) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (1R,2R,4aS,4bR,6S,7S,10aS)-2-acetyloxy-7-ethenyl-6-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,2R,4aS,4bR,6S,7S,10aS)-2-acetyloxy-7-ethenyl-6-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 118716355 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (1R,2R,4aS,4bR,6S,7S,10aS)-2-acetyloxy-7-ethenyl-6-hydroxy-1,4a,7-trimethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | C=C[C@@]1(C)C=C2CC[C@H]3[C@@](C)(CC[C@@H](OC(C)=O)[C@]3(C)C(=O)O)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H32O5/c1-6-20(3)12-14-7-8-16-21(4,15(14)11-17(20)24)10-9-18(27-13(2)23)22(16,5)19(25)26/h6,12,15-18,24H,1,7-11H2,2-5H3,(H,25,26)/t15-,16+,17+,18-,20+,21+,22-/m1/s1 |
| InChIKey | KCEXVNMMUVSVAQ-KJHUPWGBSA-N |
| XLogP | 3.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|