About 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one
3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one (PubChem CID 118716463) has the molecular formula C21H17ClN4O3
and a molecular weight of 408.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one |
| PubChem CID | 118716463 |
| Molecular Formula | C21H17ClN4O3 |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one |
| SMILES | Cc1[nH]n(C)c(=O)c1C(=O)c1ccc2nc(C)n(-c3ccc(Cl)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C21H17ClN4O3/c1-11-18(21(29)25(3)24-11)19(27)13-4-9-17-16(10-13)20(28)26(12(2)23-17)15-7-5-14(22)6-8-15/h4-10,24H,1-3H3 |
| InChIKey | LHJNCJGOJDYWOV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one (CID 118716463) is 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one is Cc1[nH]n(C)c(=O)c1C(=O)c1ccc2nc(C)n(-c3ccc(Cl)cc3)c(=O)c2c1.
What is the InChIKey of 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one?
The InChIKey is LHJNCJGOJDYWOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O3/c1-11-18(21(29)25(3)24-11)19(27)13-4-9-17-16(10-13)20(28)26(12(2)23-17)15-7-5-14(22)6-8-15/h4-10,24H,1-3H3.
What are the key properties of 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one?
3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one has a molecular weight of 408.85 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-6-(2,5-dimethyl-3-oxo-1H-pyrazole-4-carbonyl)-2-methylquinazolin-4-one is sourced from PubChem (CID 118716463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).