C27H36N2O2 — CID 118716673
methyl 4-[(5R,6R,9R,13S)-7-(naphthalen-1-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 118716673) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9R,13S)-7-(naphthalen-1-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9R,13S)-7-(naphthalen-1-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 118716673 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | methyl 4-[(5R,6R,9R,13S)-7-(naphthalen-1-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1cccc4ccccc14)[C@@H]23 |
| InChI | InChI=1S/C27H36N2O2/c1-31-26(30)15-5-14-25-24-13-7-17-28-16-6-11-22(27(24)28)19-29(25)18-21-10-4-9-20-8-2-3-12-23(20)21/h2-4,8-10,12,22,24-25,27H,5-7,11,13-19H2,1H3/t22-,24-,25-,27+/m1/s1 |
| InChIKey | CSNFOPIQXZMKJQ-YUHKXCSQSA-N |
| XLogP | 4.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |