C31H38N2O2 — CID 118716675
methyl 4-[(5R,6R,9R,13S)-7-(anthracen-9-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 118716675) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9R,13S)-7-(anthracen-9-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9R,13S)-7-(anthracen-9-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 118716675 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl 4-[(5R,6R,9R,13S)-7-(anthracen-9-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1c4ccccc4cc4ccccc14)[C@@H]23 |
| InChI | InChI=1S/C31H38N2O2/c1-35-30(34)16-6-15-29-27-14-8-18-32-17-7-11-24(31(27)32)20-33(29)21-28-25-12-4-2-9-22(25)19-23-10-3-5-13-26(23)28/h2-5,9-10,12-13,19,24,27,29,31H,6-8,11,14-18,20-21H2,1H3/t24-,27-,29-,31+/m1/s1 |
| InChIKey | WJZFMNPQSYXHNO-FXPGQOCSSA-N |
| XLogP | 6.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|