About 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one
4-methyl-[1]benzothiolo[3,2-h]chromen-2-one (PubChem CID 118716757) has the molecular formula C16H10O2S
and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one.
Molecular Properties
| Compound Name | 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one |
| PubChem CID | 118716757 |
| Molecular Formula | C16H10O2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c1ccc1c3ccccc3sc12 |
| InChI | InChI=1S/C16H10O2S/c1-9-8-14(17)18-15-10(9)6-7-12-11-4-2-3-5-13(11)19-16(12)15/h2-8H,1H3 |
| InChIKey | GFGBTQOHYWHURY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one?
The IUPAC name of 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one (CID 118716757) is 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one.
What is the SMILES notation for 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one?
The canonical SMILES for 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one is Cc1cc(=O)oc2c1ccc1c3ccccc3sc12.
What is the InChIKey of 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one?
The InChIKey is GFGBTQOHYWHURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O2S/c1-9-8-14(17)18-15-10(9)6-7-12-11-4-2-3-5-13(11)19-16(12)15/h2-8H,1H3.
What are the key properties of 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one?
4-methyl-[1]benzothiolo[3,2-h]chromen-2-one has a molecular weight of 266.32 g/mol, XLogP of 4.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-[1]benzothiolo[3,2-h]chromen-2-one is sourced from PubChem (CID 118716757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).