C15H12F4N2O2S — CID 118716964
4-[2-[(2,3,5,6-tetrafluorophenyl)methylideneamino]ethyl]benzenesulfonamide (PubChem CID 118716964) has the molecular formula C15H12F4N2O2S and a molecular weight of 360.33 g/mol. Its IUPAC name is 4-[2-[(2,3,5,6-tetrafluorophenyl)methylideneamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2,3,5,6-tetrafluorophenyl)methylideneamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 118716964 |
| Molecular Formula | C15H12F4N2O2S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-[2-[(2,3,5,6-tetrafluorophenyl)methylideneamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC/N=C/c2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C15H12F4N2O2S/c16-12-7-13(17)15(19)11(14(12)18)8-21-6-5-9-1-3-10(4-2-9)24(20,22)23/h1-4,7-8H,5-6H2,(H2,20,22,23)/b21-8+ |
| InChIKey | KAZYEEVJLLUSRB-ODCIPOBUSA-N |
| XLogP | 2.55 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|