C11H10N2O2S — CID 118717013
12,14-dioxa-3-thia-7,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,8,10,15-tetraene (PubChem CID 118717013) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 12,14-dioxa-3-thia-7,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,8,10,15-tetraene.
| Compound Name | 12,14-dioxa-3-thia-7,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,8,10,15-tetraene |
|---|---|
| PubChem CID | 118717013 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 12,14-dioxa-3-thia-7,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1,8,10,15-tetraene |
| SMILES | c1c2c(cc3c4n(nc13)CCCS4)OCO2 |
| InChI | InChI=1S/C11H10N2O2S/c1-2-13-11(16-3-1)7-4-9-10(15-6-14-9)5-8(7)12-13/h4-5H,1-3,6H2 |
| InChIKey | AYEKXMHCDUFNRO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |