About N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride
N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride (PubChem CID 118717219) has the molecular formula C19H20ClN3O
and a molecular weight of 341.84 g/mol. Its IUPAC name is N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride |
| PubChem CID | 118717219 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1ccc2c(c1)C1(CCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C19H19N3O.ClH/c20-18(21)22-17(23)12-7-8-14-13-5-1-2-6-15(13)19(16(14)11-12)9-3-4-10-19;/h1-2,5-8,11H,3-4,9-10H2,(H4,20,21,22,23);1H |
| InChIKey | RFNDSJMDWJTKDV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride?
The IUPAC name of N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride (CID 118717219) is N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride.
What is the SMILES notation for N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride?
The canonical SMILES for N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride is Cl.NC(N)=NC(=O)c1ccc2c(c1)C1(CCCC1)c1ccccc1-2.
What is the InChIKey of N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride?
The InChIKey is RFNDSJMDWJTKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O.ClH/c20-18(21)22-17(23)12-7-8-14-13-5-1-2-6-15(13)19(16(14)11-12)9-3-4-10-19;/h1-2,5-8,11H,3-4,9-10H2,(H4,20,21,22,23);1H.
What are the key properties of N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride?
N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride has a molecular weight of 341.84 g/mol, XLogP of 3.36, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)spiro[cyclopentane-1,9'-fluorene]-2'-carboxamide;hydrochloride is sourced from PubChem (CID 118717219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).