C30H39NO3 — CID 118717302
methyl (2S)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-phenylpropanoate (PubChem CID 118717302) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is methyl (2S)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 118717302 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | methyl (2S)-2-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@]1(C)CCC[C@]2(C)c3ccc(C(C)C)cc3CC[C@@H]12 |
| InChI | InChI=1S/C30H39NO3/c1-20(2)22-12-14-24-23(19-22)13-15-26-29(24,3)16-9-17-30(26,4)28(33)31-25(27(32)34-5)18-21-10-7-6-8-11-21/h6-8,10-12,14,19-20,25-26H,9,13,15-18H2,1-5H3,(H,31,33)/t25-,26+,29+,30+/m0/s1 |
| InChIKey | ABWOYWZNJHHWCD-FFDQPCAYSA-N |
| XLogP | 5.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |