C28H34F3N — CID 118717331
N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 118717331) has the molecular formula C28H34F3N and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 118717331 |
| Molecular Formula | C28H34F3N |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | N-[[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-1-[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(C/N=C/c3ccc(C(F)(F)F)cc3)CCC[C@]21C |
| InChI | InChI=1S/C28H34F3N/c1-19(2)21-8-12-24-22(16-21)9-13-25-26(3,14-5-15-27(24,25)4)18-32-17-20-6-10-23(11-7-20)28(29,30)31/h6-8,10-12,16-17,19,25H,5,9,13-15,18H2,1-4H3/b32-17+/t25-,26-,27+/m0/s1 |
| InChIKey | QAUREKNYQZXPLW-ONMUPNJASA-N |
| XLogP | 7.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|