About N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide
N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide (PubChem CID 118717387) has the molecular formula C21H24FN3O3S
and a molecular weight of 417.51 g/mol. Its IUPAC name is N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide.
Molecular Properties
| Compound Name | N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide |
| PubChem CID | 118717387 |
| Molecular Formula | C21H24FN3O3S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide |
| SMILES | O=C(CCn1sc2cccc(F)c2c1=O)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24FN3O3S/c22-15-2-1-3-16-18(15)19(27)25(29-16)5-4-17(26)23-24-20(28)21-9-12-6-13(10-21)8-14(7-12)11-21/h1-3,12-14H,4-11H2,(H,23,26)(H,24,28) |
| InChIKey | APWQEHXONFBVFY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide?
The IUPAC name of N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide (CID 118717387) is N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide.
What is the SMILES notation for N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide?
The canonical SMILES for N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide is O=C(CCn1sc2cccc(F)c2c1=O)NNC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide?
The InChIKey is APWQEHXONFBVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FN3O3S/c22-15-2-1-3-16-18(15)19(27)25(29-16)5-4-17(26)23-24-20(28)21-9-12-6-13(10-21)8-14(7-12)11-21/h1-3,12-14H,4-11H2,(H,23,26)(H,24,28).
What are the key properties of N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide?
N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide has a molecular weight of 417.51 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(4-fluoro-3-oxo-1,2-benzothiazol-2-yl)propanoyl]adamantane-1-carbohydrazide is sourced from PubChem (CID 118717387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).