C32H41NO2 — CID 118717410
[(4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-(1H-indol-3-yl)butanoate (PubChem CID 118717410) has the molecular formula C32H41NO2 and a molecular weight of 471.69 g/mol. Its IUPAC name is [(4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [(4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 118717410 |
| Molecular Formula | C32H41NO2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | [(4bS,8aS)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl] 4-(1H-indol-3-yl)butanoate |
| SMILES | CC(C)c1cc2c(cc1OC(=O)CCCc1c[nH]c3ccccc13)[C@@]1(C)CCCC(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C32H41NO2/c1-21(2)25-18-22-14-15-29-31(3,4)16-9-17-32(29,5)26(22)19-28(25)35-30(34)13-8-10-23-20-33-27-12-7-6-11-24(23)27/h6-7,11-12,18-21,29,33H,8-10,13-17H2,1-5H3/t29-,32+/m0/s1 |
| InChIKey | CKLGFWKLXJGKDY-BHDXBOSCSA-N |
| XLogP | 8.25 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|