C37H37N5O — CID 118717426
1-phenyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 118717426) has the molecular formula C37H37N5O and a molecular weight of 567.74 g/mol. Its IUPAC name is 1-phenyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-phenyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 118717426 |
| Molecular Formula | C37H37N5O |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 1-phenyl-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | O=C(NCCCCCCNc1c2c(nc3ccccc13)CCCC2)c1cc2c([nH]c3ccccc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C37H37N5O/c43-37(33-24-29-26-16-6-9-19-30(26)41-36(29)34(42-33)25-14-4-3-5-15-25)39-23-13-2-1-12-22-38-35-27-17-7-10-20-31(27)40-32-21-11-8-18-28(32)35/h3-7,9-10,14-17,19-20,24,41H,1-2,8,11-13,18,21-23H2,(H,38,40)(H,39,43) |
| InChIKey | XKKFXCKMPXLPKK-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|