C38H39N5O2 — CID 118717428
1-(4-methoxyphenyl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 118717428) has the molecular formula C38H39N5O2 and a molecular weight of 597.76 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 118717428 |
| Molecular Formula | C38H39N5O2 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)NCCCCCCNc3c4c(nc5ccccc35)CCCC4)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C38H39N5O2/c1-45-26-20-18-25(19-21-26)35-37-30(27-12-4-7-15-31(27)42-37)24-34(43-35)38(44)40-23-11-3-2-10-22-39-36-28-13-5-8-16-32(28)41-33-17-9-6-14-29(33)36/h4-5,7-8,12-13,15-16,18-21,24,42H,2-3,6,9-11,14,17,22-23H2,1H3,(H,39,41)(H,40,44) |
| InChIKey | ZXEXKQSBZMYPAQ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|