C36H45N5O3 — CID 118717429
tert-butyl (3S)-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 118717429) has the molecular formula C36H45N5O3 and a molecular weight of 595.79 g/mol. Its IUPAC name is tert-butyl (3S)-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 118717429 |
| Molecular Formula | C36H45N5O3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | tert-butyl (3S)-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)NCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C36H45N5O3/c1-36(2,3)44-35(43)41-23-31-27(24-14-6-9-17-28(24)40-31)22-32(41)34(42)38-21-13-5-4-12-20-37-33-25-15-7-10-18-29(25)39-30-19-11-8-16-26(30)33/h6-7,9-10,14-15,17-18,32,40H,4-5,8,11-13,16,19-23H2,1-3H3,(H,37,39)(H,38,42)/t32-/m0/s1 |
| InChIKey | UTSQNVLOMVPCIW-YTTGMZPUSA-N |
| XLogP | 7.05 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|