C37H47N5O3 — CID 118717430
tert-butyl (3S)-1-methyl-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 118717430) has the molecular formula C37H47N5O3 and a molecular weight of 609.82 g/mol. Its IUPAC name is tert-butyl (3S)-1-methyl-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl (3S)-1-methyl-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 118717430 |
| Molecular Formula | C37H47N5O3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | tert-butyl (3S)-1-methyl-3-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1c2[nH]c3ccccc3c2C[C@@H](C(=O)NCCCCCCNc2c3c(nc4ccccc24)CCCC3)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H47N5O3/c1-24-33-28(25-15-7-10-18-29(25)41-33)23-32(42(24)36(44)45-37(2,3)4)35(43)39-22-14-6-5-13-21-38-34-26-16-8-11-19-30(26)40-31-20-12-9-17-27(31)34/h7-8,10-11,15-16,18-19,24,32,41H,5-6,9,12-14,17,20-23H2,1-4H3,(H,38,40)(H,39,43)/t24?,32-/m0/s1 |
| InChIKey | HLSFNIKGKKTOIA-TWAVRPEISA-N |
| XLogP | 7.61 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|