C22H21NO4 — CID 118717705
1-[3-(3,4-dihydroxyphenyl)propanoyl]-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-6-one (PubChem CID 118717705) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-[3-(3,4-dihydroxyphenyl)propanoyl]-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[3-(3,4-dihydroxyphenyl)propanoyl]-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 118717705 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-[3-(3,4-dihydroxyphenyl)propanoyl]-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCC(/C=C/c2ccccc2)N1C(=O)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H21NO4/c24-19-13-10-17(15-20(19)25)11-14-22(27)23-18(7-4-8-21(23)26)12-9-16-5-2-1-3-6-16/h1-6,8-10,12-13,15,18,24-25H,7,11,14H2/b12-9+ |
| InChIKey | SLPNRXQIGPBIGF-FMIVXFBMSA-N |
| XLogP | 3.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|