C16H16N6O3 — CID 118717929
2-[(Z)-1-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]ethylideneamino]guanidine (PubChem CID 118717929) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[(Z)-1-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]ethylideneamino]guanidine.
| Compound Name | 2-[(Z)-1-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 118717929 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[(Z)-1-[2-[(3-oxido-2,1,3-benzoxadiazol-3-ium-5-yl)methoxy]phenyl]ethylideneamino]guanidine |
| SMILES | C/C(=N/N=C(N)N)c1ccccc1OCc1ccc2no[n+]([O-])c2c1 |
| InChI | InChI=1S/C16H16N6O3/c1-10(19-20-16(17)18)12-4-2-3-5-15(12)24-9-11-6-7-13-14(8-11)22(23)25-21-13/h2-8H,9H2,1H3,(H4,17,18,20)/b19-10- |
| InChIKey | DZYHZDVFFNGDGA-GRSHGNNSSA-N |
| XLogP | 1.04 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|