C20H18FN5 — CID 118717942
2-[4-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]acetonitrile (PubChem CID 118717942) has the molecular formula C20H18FN5 and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[4-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 118717942 |
| Molecular Formula | C20H18FN5 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[4-[[8-(4-fluorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(Nc2nc3n(n2)CCCC3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H18FN5/c21-16-7-5-15(6-8-16)18-2-1-13-26-19(18)24-20(25-26)23-17-9-3-14(4-10-17)11-12-22/h3-10,18H,1-2,11,13H2,(H,23,25) |
| InChIKey | UVUFHBHHORVNIB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |