C22H22FN7O — CID 118717943
8-(4-fluorophenyl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 118717943) has the molecular formula C22H22FN7O and a molecular weight of 419.46 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(4-fluorophenyl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 118717943 |
| Molecular Formula | C22H22FN7O |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 8-(4-fluorophenyl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3n(n2)CCCC3c2ccc(F)cc2)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C22H22FN7O/c1-14-24-13-30(27-14)19-10-9-17(12-20(19)31-2)25-22-26-21-18(4-3-11-29(21)28-22)15-5-7-16(23)8-6-15/h5-10,12-13,18H,3-4,11H2,1-2H3,(H,25,28) |
| InChIKey | NORCRZDORGFXKI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |