C27H29BrN2 — CID 118718011
(1R,8S,10S)-3-bromo-11,11-dimethyl-10-(2-methylprop-2-enyl)-9-(quinolin-4-ylmethyl)-9-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (PubChem CID 118718011) has the molecular formula C27H29BrN2 and a molecular weight of 461.45 g/mol. Its IUPAC name is (1R,8S,10S)-3-bromo-11,11-dimethyl-10-(2-methylprop-2-enyl)-9-(quinolin-4-ylmethyl)-9-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1R,8S,10S)-3-bromo-11,11-dimethyl-10-(2-methylprop-2-enyl)-9-(quinolin-4-ylmethyl)-9-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 118718011 |
| Molecular Formula | C27H29BrN2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (1R,8S,10S)-3-bromo-11,11-dimethyl-10-(2-methylprop-2-enyl)-9-(quinolin-4-ylmethyl)-9-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| SMILES | C=C(C)C[C@H]1[C@H]2c3c(Br)cccc3[C@H](CC2(C)C)N1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C27H29BrN2/c1-17(2)14-23-26-25-20(9-7-10-21(25)28)24(15-27(26,3)4)30(23)16-18-12-13-29-22-11-6-5-8-19(18)22/h5-13,23-24,26H,1,14-16H2,2-4H3/t23-,24-,26-/m0/s1 |
| InChIKey | KDFQIICGIIYXMB-GNKBHMEESA-N |
| XLogP | 7.40 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|