C23H35NO2 — CID 118718140
(1R,3aS,3bR,4R,9aR,9bS,11aS)-4,6,9a,11a-tetramethylspiro[2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]quinoline-1,2'-oxolane]-7-one (PubChem CID 118718140) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (1R,3aS,3bR,4R,9aR,9bS,11aS)-4,6,9a,11a-tetramethylspiro[2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]quinoline-1,2'-oxolane]-7-one.
| Compound Name | (1R,3aS,3bR,4R,9aR,9bS,11aS)-4,6,9a,11a-tetramethylspiro[2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]quinoline-1,2'-oxolane]-7-one |
|---|---|
| PubChem CID | 118718140 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (1R,3aS,3bR,4R,9aR,9bS,11aS)-4,6,9a,11a-tetramethylspiro[2,3,3a,3b,4,8,9,9b,10,11-decahydroindeno[5,4-f]quinoline-1,2'-oxolane]-7-one |
| SMILES | C[C@H]1C=C2N(C)C(=O)CC[C@]2(C)[C@H]2CC[C@@]3(C)[C@@H](CC[C@@]34CCCO4)[C@H]12 |
| InChI | InChI=1S/C23H35NO2/c1-15-14-18-21(2,10-8-19(25)24(18)4)16-6-11-22(3)17(20(15)16)7-12-23(22)9-5-13-26-23/h14-17,20H,5-13H2,1-4H3/t15-,16-,17-,20+,21+,22-,23-/m0/s1 |
| InChIKey | SSFLLJHYNMDQDP-PMSBNLIDSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |