About N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride
N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride (PubChem CID 118718251) has the molecular formula C17H25ClN2O
and a molecular weight of 308.85 g/mol. Its IUPAC name is N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride |
| PubChem CID | 118718251 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride |
| SMILES | CCC(=O)N(c1ccccc1)C1C[C@H]2CC[C@@H](C1)N2C.Cl |
| InChI | InChI=1S/C17H24N2O.ClH/c1-3-17(20)19(13-7-5-4-6-8-13)16-11-14-9-10-15(12-16)18(14)2;/h4-8,14-16H,3,9-12H2,1-2H3;1H/t14-,15+,16?; |
| InChIKey | CGEMVQYPDWJHKQ-JXMYBXCISA-N |
| XLogP | 3.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride?
The IUPAC name of N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride (CID 118718251) is N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride.
What is the SMILES notation for N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride?
The canonical SMILES for N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride is CCC(=O)N(c1ccccc1)C1C[C@H]2CC[C@@H](C1)N2C.Cl.
What is the InChIKey of N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride?
The InChIKey is CGEMVQYPDWJHKQ-JXMYBXCISA-N. The full InChI is InChI=1S/C17H24N2O.ClH/c1-3-17(20)19(13-7-5-4-6-8-13)16-11-14-9-10-15(12-16)18(14)2;/h4-8,14-16H,3,9-12H2,1-2H3;1H/t14-,15+,16?;.
What are the key properties of N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride?
N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride has a molecular weight of 308.85 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-N-phenylpropanamide;hydrochloride is sourced from PubChem (CID 118718251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).