About N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride
N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride (PubChem CID 118718256) has the molecular formula C19H27ClN2O
and a molecular weight of 334.89 g/mol. Its IUPAC name is N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride.
Molecular Properties
| Compound Name | N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride |
| PubChem CID | 118718256 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride |
| SMILES | C=CCN1[C@@H]2CC[C@H]1CC(N(C(=O)CC)c1ccccc1)C2.Cl |
| InChI | InChI=1S/C19H26N2O.ClH/c1-3-12-20-16-10-11-17(20)14-18(13-16)21(19(22)4-2)15-8-6-5-7-9-15;/h3,5-9,16-18H,1,4,10-14H2,2H3;1H/t16-,17+,18?; |
| InChIKey | HFSGOZTWPIAEMC-IESHXZMMSA-N |
| XLogP | 4.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride?
The IUPAC name of N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride (CID 118718256) is N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride.
What is the SMILES notation for N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride?
The canonical SMILES for N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride is C=CCN1[C@@H]2CC[C@H]1CC(N(C(=O)CC)c1ccccc1)C2.Cl.
What is the InChIKey of N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride?
The InChIKey is HFSGOZTWPIAEMC-IESHXZMMSA-N. The full InChI is InChI=1S/C19H26N2O.ClH/c1-3-12-20-16-10-11-17(20)14-18(13-16)21(19(22)4-2)15-8-6-5-7-9-15;/h3,5-9,16-18H,1,4,10-14H2,2H3;1H/t16-,17+,18?;.
What are the key properties of N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride?
N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride has a molecular weight of 334.89 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-N-[(1S,5R)-8-prop-2-enyl-8-azabicyclo[3.2.1]octan-3-yl]propanamide;hydrochloride is sourced from PubChem (CID 118718256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).