C21H26O5S — CID 118718364
(1S,4S,5R,8S,12S,13R)-1,5-dimethyl-9-(phenylsulfanylmethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 118718364) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is (1S,4S,5R,8S,12S,13R)-1,5-dimethyl-9-(phenylsulfanylmethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1S,4S,5R,8S,12S,13R)-1,5-dimethyl-9-(phenylsulfanylmethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 118718364 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1S,4S,5R,8S,12S,13R)-1,5-dimethyl-9-(phenylsulfanylmethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2C(CSc3ccccc3)C(=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C21H26O5S/c1-13-8-9-17-15(12-27-14-6-4-3-5-7-14)18(22)23-19-21(17)16(13)10-11-20(2,24-19)25-26-21/h3-7,13,15-17,19H,8-12H2,1-2H3/t13-,15?,16+,17+,19-,20+,21-/m1/s1 |
| InChIKey | OCZSYYGYYJECSV-JDZIBLOCSA-N |
| XLogP | 4.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|