C10H19NO6 — CID 118718371
(1S,2S,3R,6S)-6-(1,3-dihydroxypropan-2-ylamino)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 118718371) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is (1S,2S,3R,6S)-6-(1,3-dihydroxypropan-2-ylamino)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R,6S)-6-(1,3-dihydroxypropan-2-ylamino)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 118718371 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (1S,2S,3R,6S)-6-(1,3-dihydroxypropan-2-ylamino)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | OCC1=C[C@H](NC(CO)CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H19NO6/c12-2-5-1-7(11-6(3-13)4-14)9(16)10(17)8(5)15/h1,6-17H,2-4H2/t7-,8+,9-,10-/m0/s1 |
| InChIKey | IPQJPZKISYBTAQ-JXUBOQSCSA-N |
| XLogP | -3.69 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|