C25H42O6 — CID 118718422
[(4S,5S,6S,8aR)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,6-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-4-yl] 2,2-dimethylbutanoate (PubChem CID 118718422) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is [(4S,5S,6S,8aR)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,6-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-4-yl] 2,2-dimethylbutanoate.
| Compound Name | [(4S,5S,6S,8aR)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,6-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-4-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118718422 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | [(4S,5S,6S,8aR)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-2,2,6-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-4-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)(C)O[C@@H]2CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)C12 |
| InChI | InChI=1S/C25H42O6/c1-7-24(3,4)23(28)30-20-14-25(5,6)31-19-11-8-15(2)18(22(19)20)10-9-17-12-16(26)13-21(27)29-17/h15-20,22,26H,7-14H2,1-6H3/t15-,16+,17+,18-,19+,20?,22?/m0/s1 |
| InChIKey | SCTOXHHZCUZJNZ-MTSBKCFJSA-N |
| XLogP | 4.41 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |