C27H42O6 — CID 118718596
[(1R,2S,3S,7S,8S)-2-[(1S)-1-hydroxyethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 118718596) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is [(1R,2S,3S,7S,8S)-2-[(1S)-1-hydroxyethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1R,2S,3S,7S,8S)-2-[(1S)-1-hydroxyethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118718596 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(1R,2S,3S,7S,8S)-2-[(1S)-1-hydroxyethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@@H]1C2C(=C[C@H](C)[C@H]1[C@H](C)O)C=C[C@H](C)[C@@H]2CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H42O6/c1-7-27(5,6)26(31)33-25-23(17(4)28)16(3)12-18-9-8-15(2)21(24(18)25)11-10-20-13-19(29)14-22(30)32-20/h8-9,12,15-17,19-21,23-25,28-29H,7,10-11,13-14H2,1-6H3/t15-,16-,17-,19+,20+,21-,23-,24?,25-/m0/s1 |
| InChIKey | UAZAZQMZBSKATJ-PYDXRERUSA-N |
| XLogP | 4.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |