C22H25N5O6 — CID 118718819
2-benzyl-1-cyano-3-[(2S,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]guanidine (PubChem CID 118718819) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-benzyl-1-cyano-3-[(2S,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]guanidine.
| Compound Name | 2-benzyl-1-cyano-3-[(2S,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]guanidine |
|---|---|
| PubChem CID | 118718819 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-benzyl-1-cyano-3-[(2S,3R,4R)-2-(dimethoxymethyl)-3-hydroxy-2-methyl-6-nitro-3,4-dihydrochromen-4-yl]guanidine |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N/C(=N/Cc2ccccc2)NC#N)[C@H]1O |
| InChI | InChI=1S/C22H25N5O6/c1-22(20(31-2)32-3)19(28)18(16-11-15(27(29)30)9-10-17(16)33-22)26-21(25-13-23)24-12-14-7-5-4-6-8-14/h4-11,18-20,28H,12H2,1-3H3,(H2,24,25,26)/t18-,19-,22+/m1/s1 |
| InChIKey | ZTGOJUNRXOKHRM-KNKQGSTJSA-N |
| XLogP | 1.98 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|