C29H48O2 — CID 118718905
(2S,8R)-8-[(E)-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-ol (PubChem CID 118718905) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is (2S,8R)-8-[(E)-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-ol.
| Compound Name | (2S,8R)-8-[(E)-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 118718905 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | (2S,8R)-8-[(E)-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,2,3,4,5,6,7,8-octahydronaphthalen-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2/C(=C/[C@H]3CCCC4=C3C[C@@H](O)CC4)CCC[C@]12C |
| InChI | InChI=1S/C29H48O2/c1-20(8-6-16-28(2,3)31)26-14-15-27-23(11-7-17-29(26,27)4)18-22-10-5-9-21-12-13-24(30)19-25(21)22/h18,20,22,24,26-27,30-31H,5-17,19H2,1-4H3/b23-18+/t20-,22-,24+,26-,27+,29-/m1/s1 |
| InChIKey | PLBNAEMTKYWQIE-SOTJTEHXSA-N |
| XLogP | 7.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|