C8H13N3O7 — CID 118719332
(5S,7S,8S,9S,10S)-3-amino-8,9,10-trihydroxy-7-(hydroxymethyl)-6-oxa-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 118719332) has the molecular formula C8H13N3O7 and a molecular weight of 263.21 g/mol. Its IUPAC name is (5S,7S,8S,9S,10S)-3-amino-8,9,10-trihydroxy-7-(hydroxymethyl)-6-oxa-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,7S,8S,9S,10S)-3-amino-8,9,10-trihydroxy-7-(hydroxymethyl)-6-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 118719332 |
| Molecular Formula | C8H13N3O7 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (5S,7S,8S,9S,10S)-3-amino-8,9,10-trihydroxy-7-(hydroxymethyl)-6-oxa-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | NN1C(=O)N[C@@]2(O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)C1=O |
| InChI | InChI=1S/C8H13N3O7/c9-11-6(16)8(10-7(11)17)5(15)4(14)3(13)2(1-12)18-8/h2-5,12-15H,1,9H2,(H,10,17)/t2-,3+,4-,5-,8-/m0/s1 |
| InChIKey | KLJXQBRQPPSXPZ-AZDHXYLBSA-N |
| XLogP | -4.42 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|