C52H68O18 — CID 118719345
CID 118719345 (PubChem CID 118719345) has the molecular formula C52H68O18 and a molecular weight of 981.10 g/mol.
| Compound Name | CID 118719345 |
|---|---|
| PubChem CID | 118719345 |
| Molecular Formula | C52H68O18 |
| Molecular Weight | 981.10 g/mol |
| Exact Mass | 980.44 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1C[C@@H]2C[C@@]3(C(=O)[C@]24CC[C@@]42C(=O)[C@]45C[C@H]2C[C@H](OC(C)=O)[C@H]4[C@]2(C)[C@@H](OC(C)=O)C[C@H](O)C(C)(C)[C@H]2C(=O)[C@@H]5O)[C@@H]1[C@]1(C)[C@@H](OC(C)=O)C[C@H](OC(C)=O)C(C)(C)[C@H]1C(=O)[C@@H]3OC(C)=O |
| InChI | InChI=1S/C52H68O18/c1-21(53)65-29-15-27-19-49(37(29)47(11)33(68-24(4)56)17-31(59)45(7,8)39(47)35(60)41(49)62)43(63)51(27)13-14-52(51)28-16-30(66-22(2)54)38-48(12)34(69-25(5)57)18-32(67-23(3)55)46(9,10)40(48)36(61)42(70-26(6)58)50(38,20-28)44(52)64/h27-34,37-42,59,62H,13-20H2,1-12H3/t27-,28-,29+,30+,31+,32+,33+,34+,37+,38+,39-,40-,41+,42+,47+,48+,49-,50-,51-,52+/m1/s1 |
| InChIKey | YCCKLFHUWRCZJG-QXNZXIDYSA-N |
| XLogP | 3.53 |
| TPSA | 266.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.10 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|