About N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline (PubChem CID 118719371) has the molecular formula C27H32N2O3
and a molecular weight of 432.56 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline.
Molecular Properties
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline |
| PubChem CID | 118719371 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(-c2ccc(NCCCN3CCc4cc(OC)c(OC)cc4C3)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O3/c1-30-25-11-7-21(8-12-25)20-5-9-24(10-6-20)28-14-4-15-29-16-13-22-17-26(31-2)27(32-3)18-23(22)19-29/h5-12,17-18,28H,4,13-16,19H2,1-3H3 |
| InChIKey | UJKJUHUUFKTEDM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline?
The IUPAC name of N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline (CID 118719371) is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline.
What is the SMILES notation for N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline?
The canonical SMILES for N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline is COc1ccc(-c2ccc(NCCCN3CCc4cc(OC)c(OC)cc4C3)cc2)cc1.
What is the InChIKey of N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline?
The InChIKey is UJKJUHUUFKTEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N2O3/c1-30-25-11-7-21(8-12-25)20-5-9-24(10-6-20)28-14-4-15-29-16-13-22-17-26(31-2)27(32-3)18-23(22)19-29/h5-12,17-18,28H,4,13-16,19H2,1-3H3.
What are the key properties of N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline?
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline has a molecular weight of 432.56 g/mol, XLogP of 5.24, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(4-methoxyphenyl)aniline is sourced from PubChem (CID 118719371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).