C23H27N7O4S — CID 118719446
10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 118719446) has the molecular formula C23H27N7O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 118719446 |
| Molecular Formula | C23H27N7O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 10-(2-morpholin-4-ylethyl)-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(CCN3CCOCC3)nc2C(=O)NCCOCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C23H27N7O4S/c31-21-19-15-35-23(27-19)16-1-3-24-17(13-16)2-9-33-10-4-25-22(32)20-18(26-21)14-30(28-20)6-5-29-7-11-34-12-8-29/h1,3,13-15H,2,4-12H2,(H,25,32)(H,26,31) |
| InChIKey | BUIQKCSRWRGMOY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |