About 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate (PubChem CID 118719716) has the molecular formula C18H23F4NO5
and a molecular weight of 409.38 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate |
| PubChem CID | 118719716 |
| Molecular Formula | C18H23F4NO5 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate |
| SMILES | CCOc1cc(CC(=O)OCC(F)(F)F)cc(F)c1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C18H23F4NO5/c1-4-23(5-2)15(24)10-27-17-13(19)7-12(8-14(17)26-6-3)9-16(25)28-11-18(20,21)22/h7-8H,4-6,9-11H2,1-3H3 |
| InChIKey | KEMQQBPWPADRHV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate?
The IUPAC name of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate (CID 118719716) is 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate is CCOc1cc(CC(=O)OCC(F)(F)F)cc(F)c1OCC(=O)N(CC)CC.
What is the InChIKey of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate?
The InChIKey is KEMQQBPWPADRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F4NO5/c1-4-23(5-2)15(24)10-27-17-13(19)7-12(8-14(17)26-6-3)9-16(25)28-11-18(20,21)22/h7-8H,4-6,9-11H2,1-3H3.
What are the key properties of 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate?
2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate has a molecular weight of 409.38 g/mol, XLogP of 3.12, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxy-5-fluorophenyl]acetate is sourced from PubChem (CID 118719716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).