C27H31N3O5S — CID 118719733
(19S)-8-[2-(diethylamino)ethylsulfanylmethyl]-19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 118719733) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is (19S)-8-[2-(diethylamino)ethylsulfanylmethyl]-19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-8-[2-(diethylamino)ethylsulfanylmethyl]-19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 118719733 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (19S)-8-[2-(diethylamino)ethylsulfanylmethyl]-19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CCN(CC)CCSCc1c(O)ccc2nc3c(cc12)Cn1c-3cc2c(c1=O)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C27H31N3O5S/c1-4-27(34)20-12-22-24-16(13-30(22)25(32)18(20)14-35-26(27)33)11-17-19(23(31)8-7-21(17)28-24)15-36-10-9-29(5-2)6-3/h7-8,11-12,31,34H,4-6,9-10,13-15H2,1-3H3/t27-/m0/s1 |
| InChIKey | NWHHOGYAUZMZAO-MHZLTWQESA-N |
| XLogP | 3.36 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|