C27H49NO5 — CID 118719885
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoxy]pentyl]piperidine-3,4,5-triol (PubChem CID 118719885) has the molecular formula C27H49NO5 and a molecular weight of 467.69 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoxy]pentyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoxy]pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118719885 |
| Molecular Formula | C27H49NO5 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.36 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienoxy]pentyl]piperidine-3,4,5-triol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCOCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C27H49NO5/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-18-33-17-7-5-6-16-28-19-25(30)27(32)26(31)24(28)20-29/h11,13,15,24-27,29-32H,5-10,12,14,16-20H2,1-4H3/b22-13+,23-15+/t24-,25+,26-,27-/m1/s1 |
| InChIKey | NPVJKFWTZRIYHO-IUTRHFFQSA-N |
| XLogP | 3.74 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|