C18H29NO5 — CID 118719898
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-(5-phenylmethoxypentyl)piperidine-3,4,5-triol (PubChem CID 118719898) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-(5-phenylmethoxypentyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-(5-phenylmethoxypentyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118719898 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-(5-phenylmethoxypentyl)piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCc1ccccc1 |
| InChI | InChI=1S/C18H29NO5/c20-12-15-17(22)18(23)16(21)11-19(15)9-5-2-6-10-24-13-14-7-3-1-4-8-14/h1,3-4,7-8,15-18,20-23H,2,5-6,9-13H2/t15-,16-,17+,18+/m0/s1 |
| InChIKey | JLJXOROVAFNSCP-WNRNVDISSA-N |
| XLogP | 0.13 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|