C22H31NO5 — CID 118719899
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-[5-(naphthalen-2-ylmethoxy)pentyl]piperidine-3,4,5-triol (PubChem CID 118719899) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[5-(naphthalen-2-ylmethoxy)pentyl]piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[5-(naphthalen-2-ylmethoxy)pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118719899 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-[5-(naphthalen-2-ylmethoxy)pentyl]piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H31NO5/c24-14-19-21(26)22(27)20(25)13-23(19)10-4-1-5-11-28-15-16-8-9-17-6-2-3-7-18(17)12-16/h2-3,6-9,12,19-22,24-27H,1,4-5,10-11,13-15H2/t19-,20-,21+,22+/m0/s1 |
| InChIKey | RTNFUFFWGXVOPY-FNAHDJPLSA-N |
| XLogP | 1.29 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|