C25H33NO7 — CID 118719913
(2R,3R,4R,5S)-1-[5-[[4-(1,3-benzodioxol-5-yl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 118719913) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[5-[[4-(1,3-benzodioxol-5-yl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[5-[[4-(1,3-benzodioxol-5-yl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118719913 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (2R,3R,4R,5S)-1-[5-[[4-(1,3-benzodioxol-5-yl)phenyl]methoxy]pentyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCc1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C25H33NO7/c27-14-20-24(29)25(30)21(28)13-26(20)10-2-1-3-11-31-15-17-4-6-18(7-5-17)19-8-9-22-23(12-19)33-16-32-22/h4-9,12,20-21,24-25,27-30H,1-3,10-11,13-16H2/t20-,21+,24-,25-/m1/s1 |
| InChIKey | CJZGTRIZBSILBI-RRJCBXKSSA-N |
| XLogP | 1.53 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|