About [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate
[4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (PubChem CID 118719978) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
Molecular Properties
| Compound Name | [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| PubChem CID | 118719978 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate |
| SMILES | Cc1ccc(-c2ccc(COC(=O)N[C@H]3C(=O)O[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-12-3-7-15(8-4-12)16-9-5-14(6-10-16)11-23-19(22)20-17-13(2)24-18(17)21/h3-10,13,17H,11H2,1-2H3,(H,20,22)/t13-,17+/m0/s1 |
| InChIKey | PDWAHCFYZVBFAQ-SUMWQHHRSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The IUPAC name of [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate (CID 118719978) is [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate.
What is the SMILES notation for [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The canonical SMILES for [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is Cc1ccc(-c2ccc(COC(=O)N[C@H]3C(=O)O[C@H]3C)cc2)cc1.
What is the InChIKey of [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
The InChIKey is PDWAHCFYZVBFAQ-SUMWQHHRSA-N. The full InChI is InChI=1S/C19H19NO4/c1-12-3-7-15(8-4-12)16-9-5-14(6-10-16)11-23-19(22)20-17-13(2)24-18(17)21/h3-10,13,17H,11H2,1-2H3,(H,20,22)/t13-,17+/m0/s1.
What are the key properties of [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate?
[4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate has a molecular weight of 325.36 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methylphenyl)phenyl]methyl N-[(2S,3R)-2-methyl-4-oxooxetan-3-yl]carbamate is sourced from PubChem (CID 118719978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).