About 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one
2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 118719999) has the molecular formula C20H26N4O2S
and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 118719999 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | CCn1c(NC2CCCC2)nc2c(C#CCN3CCOCC3)csc2c1=O |
| InChI | InChI=1S/C20H26N4O2S/c1-2-24-19(25)18-17(22-20(24)21-16-7-3-4-8-16)15(14-27-18)6-5-9-23-10-12-26-13-11-23/h14,16H,2-4,7-13H2,1H3,(H,21,22) |
| InChIKey | HVXLYTLVGVKSCK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one (CID 118719999) is 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one is CCn1c(NC2CCCC2)nc2c(C#CCN3CCOCC3)csc2c1=O.
What is the InChIKey of 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one?
The InChIKey is HVXLYTLVGVKSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O2S/c1-2-24-19(25)18-17(22-20(24)21-16-7-3-4-8-16)15(14-27-18)6-5-9-23-10-12-26-13-11-23/h14,16H,2-4,7-13H2,1H3,(H,21,22).
What are the key properties of 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one?
2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one has a molecular weight of 386.52 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-3-ethyl-7-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 118719999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).